About O-(2,2-dimethylpropyl) 4-(2-methylpropyl)piperazine-1-carbothioate
O-(2,2-dimethylpropyl) 4-(2-methylpropyl)piperazine-1-carbothioate (PubChem CID 58756708) has the molecular formula C14H28N2OS
and a molecular weight of 272.46 g/mol. Its IUPAC name is O-(2,2-dimethylpropyl) 4-(2-methylpropyl)piperazine-1-carbothioate.
Molecular Properties
| Compound Name | O-(2,2-dimethylpropyl) 4-(2-methylpropyl)piperazine-1-carbothioate |
| PubChem CID | 58756708 |
| Molecular Formula | C14H28N2OS |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | O-(2,2-dimethylpropyl) 4-(2-methylpropyl)piperazine-1-carbothioate |
| SMILES | CC(C)CN1CCN(C(=S)OCC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H28N2OS/c1-12(2)10-15-6-8-16(9-7-15)13(18)17-11-14(3,4)5/h12H,6-11H2,1-5H3 |
| InChIKey | SEOSFZPYJRYGKU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(2,2-dimethylpropyl) 4-(2-methylpropyl)piperazine-1-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2,2-dimethylpropyl) 4-(2-methylpropyl)piperazine-1-carbothioate?
The IUPAC name of O-(2,2-dimethylpropyl) 4-(2-methylpropyl)piperazine-1-carbothioate (CID 58756708) is O-(2,2-dimethylpropyl) 4-(2-methylpropyl)piperazine-1-carbothioate.
What is the SMILES notation for O-(2,2-dimethylpropyl) 4-(2-methylpropyl)piperazine-1-carbothioate?
The canonical SMILES for O-(2,2-dimethylpropyl) 4-(2-methylpropyl)piperazine-1-carbothioate is CC(C)CN1CCN(C(=S)OCC(C)(C)C)CC1.
What is the InChIKey of O-(2,2-dimethylpropyl) 4-(2-methylpropyl)piperazine-1-carbothioate?
The InChIKey is SEOSFZPYJRYGKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2OS/c1-12(2)10-15-6-8-16(9-7-15)13(18)17-11-14(3,4)5/h12H,6-11H2,1-5H3.
What are the key properties of O-(2,2-dimethylpropyl) 4-(2-methylpropyl)piperazine-1-carbothioate?
O-(2,2-dimethylpropyl) 4-(2-methylpropyl)piperazine-1-carbothioate has a molecular weight of 272.46 g/mol, XLogP of 2.61, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2,2-dimethylpropyl) 4-(2-methylpropyl)piperazine-1-carbothioate is sourced from PubChem (CID 58756708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).