C20H27FN2O5 — CID 58757050
(2S)-1-[6-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 58757050) has the molecular formula C20H27FN2O5 and a molecular weight of 394.44 g/mol. Its IUPAC name is (2S)-1-[6-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[6-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 58757050 |
| Molecular Formula | C20H27FN2O5 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (2S)-1-[6-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(COCc1ccc(F)cc1)NCCCCCC(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C20H27FN2O5/c21-16-9-7-15(8-10-16)13-28-14-18(24)22-11-3-1-2-6-19(25)23-12-4-5-17(23)20(26)27/h7-10,17H,1-6,11-14H2,(H,22,24)(H,26,27)/t17-/m0/s1 |
| InChIKey | VTCXBXOGDZCUBZ-KRWDZBQOSA-N |
| XLogP | 2.09 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|