C19H20BNO4 — CID 58757165
4,4,5,5-tetramethyl-2-(4-nitro-9H-fluoren-1-yl)-1,3,2-dioxaborolane (PubChem CID 58757165) has the molecular formula C19H20BNO4 and a molecular weight of 337.18 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(4-nitro-9H-fluoren-1-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(4-nitro-9H-fluoren-1-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 58757165 |
| Molecular Formula | C19H20BNO4 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(4-nitro-9H-fluoren-1-yl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc([N+](=O)[O-])c3c2Cc2ccccc2-3)OC1(C)C |
| InChI | InChI=1S/C19H20BNO4/c1-18(2)19(3,4)25-20(24-18)15-9-10-16(21(22)23)17-13-8-6-5-7-12(13)11-14(15)17/h5-10H,11H2,1-4H3 |
| InChIKey | TWZYCOWBXBJHIC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|