C30H25N3O5 — CID 58757274
(3aS,7aR)-2-(4-isocyanonaphthalen-1-yl)-4-methyl-7-[2-[(6-methyl-1,2-benzoxazol-3-yl)oxy]ethyl]-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 58757274) has the molecular formula C30H25N3O5 and a molecular weight of 507.55 g/mol. Its IUPAC name is (3aS,7aR)-2-(4-isocyanonaphthalen-1-yl)-4-methyl-7-[2-[(6-methyl-1,2-benzoxazol-3-yl)oxy]ethyl]-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,7aR)-2-(4-isocyanonaphthalen-1-yl)-4-methyl-7-[2-[(6-methyl-1,2-benzoxazol-3-yl)oxy]ethyl]-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 58757274 |
| Molecular Formula | C30H25N3O5 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | (3aS,7aR)-2-(4-isocyanonaphthalen-1-yl)-4-methyl-7-[2-[(6-methyl-1,2-benzoxazol-3-yl)oxy]ethyl]-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)[C@@H]3[C@H](C2=O)C2(C)CCC3(CCOc3noc4cc(C)ccc34)O2)c2ccccc12 |
| InChI | InChI=1S/C30H25N3O5/c1-17-8-9-20-23(16-17)37-32-26(20)36-15-14-30-13-12-29(2,38-30)24-25(30)28(35)33(27(24)34)22-11-10-21(31-3)18-6-4-5-7-19(18)22/h4-11,16,24-25H,12-15H2,1-2H3/t24-,25+,29?,30?/m1/s1 |
| InChIKey | JGJBIYFFPXNANE-JNJBDABUSA-N |
| XLogP | 5.74 |
| TPSA | 86.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|