C38H42F3NO5 — CID 58757325
(2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine (PubChem CID 58757325) has the molecular formula C38H42F3NO5 and a molecular weight of 649.75 g/mol. Its IUPAC name is (2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine.
| Compound Name | (2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine |
|---|---|
| PubChem CID | 58757325 |
| Molecular Formula | C38H42F3NO5 |
| Molecular Weight | 649.75 g/mol |
| Exact Mass | 649.30 |
| IUPAC Name | (2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine |
| SMILES | FC(F)(F)COCCN1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C38H42F3NO5/c39-38(40,41)29-43-22-21-42-23-35(45-25-31-15-7-2-8-16-31)37(47-27-33-19-11-4-12-20-33)36(46-26-32-17-9-3-10-18-32)34(42)28-44-24-30-13-5-1-6-14-30/h1-20,34-37H,21-29H2/t34-,35+,36-,37-/m1/s1 |
| InChIKey | LRWANYDWZOJMBT-LADGJGSJSA-N |
| XLogP | 7.22 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.75 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|