C24H39F9O6Si4 — CID 58757751
3-[2,4,6,8-tetramethyl-4,6,8-tris(3,3,3-trifluoropropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 58757751) has the molecular formula C24H39F9O6Si4 and a molecular weight of 706.90 g/mol. Its IUPAC name is 3-[2,4,6,8-tetramethyl-4,6,8-tris(3,3,3-trifluoropropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 3-[2,4,6,8-tetramethyl-4,6,8-tris(3,3,3-trifluoropropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 58757751 |
| Molecular Formula | C24H39F9O6Si4 |
| Molecular Weight | 706.90 g/mol |
| Exact Mass | 706.17 |
| IUPAC Name | 3-[2,4,6,8-tetramethyl-4,6,8-tris(3,3,3-trifluoropropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]propyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | C[Si]1(CCCOC(=O)C2CC3C=CC2C3)O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O1 |
| InChI | InChI=1S/C24H39F9O6Si4/c1-40(12-5-11-35-21(34)20-17-18-6-7-19(20)16-18)36-41(2,13-8-22(25,26)27)38-43(4,15-10-24(31,32)33)39-42(3,37-40)14-9-23(28,29)30/h6-7,18-20H,5,8-17H2,1-4H3 |
| InChIKey | RQENRHVVTHZEBJ-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.90 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|