C39H32O2P2 — CID 58758028
3,6-bis(diphenylphosphoryl)-9,9-dimethylfluorene (PubChem CID 58758028) has the molecular formula C39H32O2P2 and a molecular weight of 594.63 g/mol. Its IUPAC name is 3,6-bis(diphenylphosphoryl)-9,9-dimethylfluorene.
| Compound Name | 3,6-bis(diphenylphosphoryl)-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 58758028 |
| Molecular Formula | C39H32O2P2 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | 3,6-bis(diphenylphosphoryl)-9,9-dimethylfluorene |
| SMILES | CC1(C)c2ccc(P(=O)(c3ccccc3)c3ccccc3)cc2-c2cc(P(=O)(c3ccccc3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C39H32O2P2/c1-39(2)37-25-23-33(42(40,29-15-7-3-8-16-29)30-17-9-4-10-18-30)27-35(37)36-28-34(24-26-38(36)39)43(41,31-19-11-5-12-20-31)32-21-13-6-14-22-32/h3-28H,1-2H3 |
| InChIKey | YXUMQZHPPZHXHP-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|