C9H21N — CID 58758115
N,N,2,4-tetramethylpentan-1-amine (PubChem CID 58758115) has the molecular formula C9H21N and a molecular weight of 143.27 g/mol. Its IUPAC name is N,N,2,4-tetramethylpentan-1-amine.
| Compound Name | N,N,2,4-tetramethylpentan-1-amine |
|---|---|
| PubChem CID | 58758115 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | N,N,2,4-tetramethylpentan-1-amine |
| SMILES | CC(C)CC(C)CN(C)C |
| InChI | InChI=1S/C9H21N/c1-8(2)6-9(3)7-10(4)5/h8-9H,6-7H2,1-5H3 |
| InChIKey | VCSNSZCOTPOLQG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |