C20H37MnN7O2-2 — CID 58758476
manganese;(1R,6R,11R,19R)-2,5,12,15,18-pentazatricyclo[17.4.0.06,11]tricosane;diisocyanate (PubChem CID 58758476) has the molecular formula C20H37MnN7O2-2 and a molecular weight of 462.50 g/mol. Its IUPAC name is manganese;(1R,6R,11R,19R)-2,5,12,15,18-pentazatricyclo[17.4.0.06,11]tricosane;diisocyanate.
| Compound Name | manganese;(1R,6R,11R,19R)-2,5,12,15,18-pentazatricyclo[17.4.0.06,11]tricosane;diisocyanate |
|---|---|
| PubChem CID | 58758476 |
| Molecular Formula | C20H37MnN7O2-2 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | manganese;(1R,6R,11R,19R)-2,5,12,15,18-pentazatricyclo[17.4.0.06,11]tricosane;diisocyanate |
| SMILES | C1CC[C@H]2NCCN[C@@H]3CCCC[C@H]3NCCNCCN[C@@H]2C1.[Mn].[N-]=C=O.[N-]=C=O |
| InChI | InChI=1S/C18H37N5.2CNO.Mn/c1-3-7-17-15(5-1)20-11-9-19-10-12-21-16-6-2-4-8-18(16)23-14-13-22-17;2*2-1-3;/h15-23H,1-14H2;;;/q;2*-1;/t15-,16-,17-,18-;;;/m1.../s1 |
| InChIKey | JLNOXHGLKGXDBQ-JDKOHWMVSA-N |
| XLogP | 0.35 |
| TPSA | 138.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|