C20H27BrN4OSi — CID 58758514
5-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylpyridin-2-amine (PubChem CID 58758514) has the molecular formula C20H27BrN4OSi and a molecular weight of 447.45 g/mol. Its IUPAC name is 5-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylpyridin-2-amine.
| Compound Name | 5-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 58758514 |
| Molecular Formula | C20H27BrN4OSi |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 5-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylpyridin-2-amine |
| SMILES | CN(C)c1ccc(-c2cnc3c(c2)c(Br)cn3COCC[Si](C)(C)C)cn1 |
| InChI | InChI=1S/C20H27BrN4OSi/c1-24(2)19-7-6-15(11-22-19)16-10-17-18(21)13-25(20(17)23-12-16)14-26-8-9-27(3,4)5/h6-7,10-13H,8-9,14H2,1-5H3 |
| InChIKey | JDHGKVGIFYMEOQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|