C28H29N5O7 — CID 58758597
(2,5-dioxocyclopentyl) [3-[3-methyl-7-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl carbonate (PubChem CID 58758597) has the molecular formula C28H29N5O7 and a molecular weight of 547.57 g/mol. Its IUPAC name is (2,5-dioxocyclopentyl) [3-[3-methyl-7-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl carbonate.
| Compound Name | (2,5-dioxocyclopentyl) [3-[3-methyl-7-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl carbonate |
|---|---|
| PubChem CID | 58758597 |
| Molecular Formula | C28H29N5O7 |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | (2,5-dioxocyclopentyl) [3-[3-methyl-7-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl carbonate |
| SMILES | CN(C(=O)OC(C)(C)C)c1nc2[nH]c(-c3cccc(COC(=O)OC4C(=O)CCC4=O)c3)cc2c2c1ncn2C |
| InChI | InChI=1S/C28H29N5O7/c1-28(2,3)40-26(36)33(5)25-21-22(32(4)14-29-21)17-12-18(30-24(17)31-25)16-8-6-7-15(11-16)13-38-27(37)39-23-19(34)9-10-20(23)35/h6-8,11-12,14,23H,9-10,13H2,1-5H3,(H,30,31) |
| InChIKey | DOOIQZBOPKMTKO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|