C16H24O5 — CID 58759104
(1R,2S,3R)-1-hydroperoxy-3-methyl-6-(3-oxobut-1-en-2-yl)-2-(3-oxobutyl)cyclohexane-1-carbaldehyde (PubChem CID 58759104) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is (1R,2S,3R)-1-hydroperoxy-3-methyl-6-(3-oxobut-1-en-2-yl)-2-(3-oxobutyl)cyclohexane-1-carbaldehyde.
| Compound Name | (1R,2S,3R)-1-hydroperoxy-3-methyl-6-(3-oxobut-1-en-2-yl)-2-(3-oxobutyl)cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 58759104 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (1R,2S,3R)-1-hydroperoxy-3-methyl-6-(3-oxobut-1-en-2-yl)-2-(3-oxobutyl)cyclohexane-1-carbaldehyde |
| SMILES | C=C(C(C)=O)C1CC[C@@H](C)[C@H](CCC(C)=O)[C@@]1(C=O)OO |
| InChI | InChI=1S/C16H24O5/c1-10-5-7-15(12(3)13(4)19)16(9-17,21-20)14(10)8-6-11(2)18/h9-10,14-15,20H,3,5-8H2,1-2,4H3/t10-,14+,15?,16-/m1/s1 |
| InChIKey | VUNULAQPMYXALI-HIESFXIUSA-N |
| XLogP | 2.59 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|