C15H17N3O — CID 58759355
6-tert-butyl-10,11-dimethyl-1,2,3-triazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),10-pentaen-9-one (PubChem CID 58759355) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 6-tert-butyl-10,11-dimethyl-1,2,3-triazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),10-pentaen-9-one.
| Compound Name | 6-tert-butyl-10,11-dimethyl-1,2,3-triazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),10-pentaen-9-one |
|---|---|
| PubChem CID | 58759355 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 6-tert-butyl-10,11-dimethyl-1,2,3-triazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),10-pentaen-9-one |
| SMILES | Cc1c(C)n2nnc3cc(C(C)(C)C)cc(c1=O)c32 |
| InChI | InChI=1S/C15H17N3O/c1-8-9(2)18-13-11(14(8)19)6-10(15(3,4)5)7-12(13)16-17-18/h6-7H,1-5H3 |
| InChIKey | PCYLSOYJPMURPU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |