C11H18NO+ — CID 58759438
4,4,5,7-tetramethyl-3,6-dihydro-2H-cyclopenta[b][1,4]oxazin-4-ium (PubChem CID 58759438) has the molecular formula C11H18NO+ and a molecular weight of 180.27 g/mol. Its IUPAC name is 4,4,5,7-tetramethyl-3,6-dihydro-2H-cyclopenta[b][1,4]oxazin-4-ium.
| Compound Name | 4,4,5,7-tetramethyl-3,6-dihydro-2H-cyclopenta[b][1,4]oxazin-4-ium |
|---|---|
| PubChem CID | 58759438 |
| Molecular Formula | C11H18NO+ |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 4,4,5,7-tetramethyl-3,6-dihydro-2H-cyclopenta[b][1,4]oxazin-4-ium |
| SMILES | CC1=C2C(=C(C1)C)OCC[N+]2(C)C |
| InChI | InChI=1S/C11H18NO/c1-8-7-9(2)11-10(8)12(3,4)5-6-13-11/h5-7H2,1-4H3/q+1 |
| InChIKey | SFRJDDLMKIVBGH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | 310 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|