About (3-amino-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-(2-fluorophenyl)methanone
(3-amino-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-(2-fluorophenyl)methanone (PubChem CID 58759569) has the molecular formula C18H14FNO2
and a molecular weight of 295.31 g/mol. Its IUPAC name is (3-amino-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-(2-fluorophenyl)methanone.
Molecular Properties
| Compound Name | (3-amino-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-(2-fluorophenyl)methanone |
| PubChem CID | 58759569 |
| Molecular Formula | C18H14FNO2 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (3-amino-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-(2-fluorophenyl)methanone |
| SMILES | Nc1c(C(=O)c2ccccc2F)oc2cc3c(cc12)CCC3 |
| InChI | InChI=1S/C18H14FNO2/c19-14-7-2-1-6-12(14)17(21)18-16(20)13-8-10-4-3-5-11(10)9-15(13)22-18/h1-2,6-9H,3-5,20H2 |
| InChIKey | LQVIWZQKPHJCBX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-amino-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-(2-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-(2-fluorophenyl)methanone?
The IUPAC name of (3-amino-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-(2-fluorophenyl)methanone (CID 58759569) is (3-amino-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-(2-fluorophenyl)methanone.
What is the SMILES notation for (3-amino-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-(2-fluorophenyl)methanone?
The canonical SMILES for (3-amino-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-(2-fluorophenyl)methanone is Nc1c(C(=O)c2ccccc2F)oc2cc3c(cc12)CCC3.
What is the InChIKey of (3-amino-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-(2-fluorophenyl)methanone?
The InChIKey is LQVIWZQKPHJCBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14FNO2/c19-14-7-2-1-6-12(14)17(21)18-16(20)13-8-10-4-3-5-11(10)9-15(13)22-18/h1-2,6-9H,3-5,20H2.
What are the key properties of (3-amino-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-(2-fluorophenyl)methanone?
(3-amino-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-(2-fluorophenyl)methanone has a molecular weight of 295.31 g/mol, XLogP of 3.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-2-yl)-(2-fluorophenyl)methanone is sourced from PubChem (CID 58759569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).