About 3-tert-butyl-2,5,7-trimethyl-1,8-naphthyridine
3-tert-butyl-2,5,7-trimethyl-1,8-naphthyridine (PubChem CID 58759587) has the molecular formula C15H20N2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-tert-butyl-2,5,7-trimethyl-1,8-naphthyridine.
Molecular Properties
| Compound Name | 3-tert-butyl-2,5,7-trimethyl-1,8-naphthyridine |
| PubChem CID | 58759587 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 3-tert-butyl-2,5,7-trimethyl-1,8-naphthyridine |
| SMILES | Cc1cc(C)c2cc(C(C)(C)C)c(C)nc2n1 |
| InChI | InChI=1S/C15H20N2/c1-9-7-10(2)16-14-12(9)8-13(11(3)17-14)15(4,5)6/h7-8H,1-6H3 |
| InChIKey | HTOTUNACVRWZSY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-2,5,7-trimethyl-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2,5,7-trimethyl-1,8-naphthyridine?
The IUPAC name of 3-tert-butyl-2,5,7-trimethyl-1,8-naphthyridine (CID 58759587) is 3-tert-butyl-2,5,7-trimethyl-1,8-naphthyridine.
What is the SMILES notation for 3-tert-butyl-2,5,7-trimethyl-1,8-naphthyridine?
The canonical SMILES for 3-tert-butyl-2,5,7-trimethyl-1,8-naphthyridine is Cc1cc(C)c2cc(C(C)(C)C)c(C)nc2n1.
What is the InChIKey of 3-tert-butyl-2,5,7-trimethyl-1,8-naphthyridine?
The InChIKey is HTOTUNACVRWZSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2/c1-9-7-10(2)16-14-12(9)8-13(11(3)17-14)15(4,5)6/h7-8H,1-6H3.
What are the key properties of 3-tert-butyl-2,5,7-trimethyl-1,8-naphthyridine?
3-tert-butyl-2,5,7-trimethyl-1,8-naphthyridine has a molecular weight of 228.34 g/mol, XLogP of 3.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2,5,7-trimethyl-1,8-naphthyridine is sourced from PubChem (CID 58759587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).