C42H77NO3 — CID 58760792
(E)-N-[(E)-2,3,5,6,8,9,10,13,14,16-decamethyl-15-oxoheptadec-7-en-4-yl]-4,4,6,7,8,8-hexamethyl-5-oxonon-2-enamide (PubChem CID 58760792) has the molecular formula C42H77NO3 and a molecular weight of 644.08 g/mol. Its IUPAC name is (E)-N-[(E)-2,3,5,6,8,9,10,13,14,16-decamethyl-15-oxoheptadec-7-en-4-yl]-4,4,6,7,8,8-hexamethyl-5-oxonon-2-enamide.
| Compound Name | (E)-N-[(E)-2,3,5,6,8,9,10,13,14,16-decamethyl-15-oxoheptadec-7-en-4-yl]-4,4,6,7,8,8-hexamethyl-5-oxonon-2-enamide |
|---|---|
| PubChem CID | 58760792 |
| Molecular Formula | C42H77NO3 |
| Molecular Weight | 644.08 g/mol |
| Exact Mass | 643.59 |
| IUPAC Name | (E)-N-[(E)-2,3,5,6,8,9,10,13,14,16-decamethyl-15-oxoheptadec-7-en-4-yl]-4,4,6,7,8,8-hexamethyl-5-oxonon-2-enamide |
| SMILES | C/C(=C\C(C)C(C)C(NC(=O)/C=C/C(C)(C)C(=O)C(C)C(C)C(C)(C)C)C(C)C(C)C)C(C)C(C)CCC(C)C(C)C(=O)C(C)C |
| InChI | InChI=1S/C42H77NO3/c1-25(2)31(9)38(43-37(44)22-23-42(18,19)40(46)35(13)36(14)41(15,16)17)33(11)30(8)24-29(7)32(10)27(5)20-21-28(6)34(12)39(45)26(3)4/h22-28,30-36,38H,20-21H2,1-19H3,(H,43,44)/b23-22+,29-24+ |
| InChIKey | SXUQFXDGPZRNTE-OIFMWSATSA-N |
| XLogP | 11.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.08 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|