About 1-ethyl-3,5-bis(isocyanomethyl)-1,3,5-triazinane
1-ethyl-3,5-bis(isocyanomethyl)-1,3,5-triazinane (PubChem CID 58761110) has the molecular formula C9H15N5
and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-ethyl-3,5-bis(isocyanomethyl)-1,3,5-triazinane.
Molecular Properties
| Compound Name | 1-ethyl-3,5-bis(isocyanomethyl)-1,3,5-triazinane |
| PubChem CID | 58761110 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 1-ethyl-3,5-bis(isocyanomethyl)-1,3,5-triazinane |
| SMILES | [C-]#[N+]CN1CN(CC)CN(C[N+]#[C-])C1 |
| InChI | InChI=1S/C9H15N5/c1-4-12-7-13(5-10-2)9-14(8-12)6-11-3/h4-9H2,1H3 |
| InChIKey | XCKFSFUAUZLWOL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 18.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3,5-bis(isocyanomethyl)-1,3,5-triazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,5-bis(isocyanomethyl)-1,3,5-triazinane?
The IUPAC name of 1-ethyl-3,5-bis(isocyanomethyl)-1,3,5-triazinane (CID 58761110) is 1-ethyl-3,5-bis(isocyanomethyl)-1,3,5-triazinane.
What is the SMILES notation for 1-ethyl-3,5-bis(isocyanomethyl)-1,3,5-triazinane?
The canonical SMILES for 1-ethyl-3,5-bis(isocyanomethyl)-1,3,5-triazinane is [C-]#[N+]CN1CN(CC)CN(C[N+]#[C-])C1.
What is the InChIKey of 1-ethyl-3,5-bis(isocyanomethyl)-1,3,5-triazinane?
The InChIKey is XCKFSFUAUZLWOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5/c1-4-12-7-13(5-10-2)9-14(8-12)6-11-3/h4-9H2,1H3.
What are the key properties of 1-ethyl-3,5-bis(isocyanomethyl)-1,3,5-triazinane?
1-ethyl-3,5-bis(isocyanomethyl)-1,3,5-triazinane has a molecular weight of 193.25 g/mol, XLogP of 0.55, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,5-bis(isocyanomethyl)-1,3,5-triazinane is sourced from PubChem (CID 58761110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).