C13H8N4O8 — CID 58761315
2-(6-ethyl-1,3,5,7-tetraoxo-2,6-diazaspiro[3.3]heptan-2-yl)-6-methyl-2,6-diazaspiro[3.3]heptane-1,3,5,7-tetrone (PubChem CID 58761315) has the molecular formula C13H8N4O8 and a molecular weight of 348.23 g/mol. Its IUPAC name is 2-(6-ethyl-1,3,5,7-tetraoxo-2,6-diazaspiro[3.3]heptan-2-yl)-6-methyl-2,6-diazaspiro[3.3]heptane-1,3,5,7-tetrone.
| Compound Name | 2-(6-ethyl-1,3,5,7-tetraoxo-2,6-diazaspiro[3.3]heptan-2-yl)-6-methyl-2,6-diazaspiro[3.3]heptane-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 58761315 |
| Molecular Formula | C13H8N4O8 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 2-(6-ethyl-1,3,5,7-tetraoxo-2,6-diazaspiro[3.3]heptan-2-yl)-6-methyl-2,6-diazaspiro[3.3]heptane-1,3,5,7-tetrone |
| SMILES | CCN1C(=O)C2(C1=O)C(=O)N(N1C(=O)C3(C(=O)N(C)C3=O)C1=O)C2=O |
| InChI | InChI=1S/C13H8N4O8/c1-3-15-6(20)13(7(15)21)10(24)17(11(13)25)16-8(22)12(9(16)23)4(18)14(2)5(12)19/h3H2,1-2H3 |
| InChIKey | FZRYXGDMTLOTPW-UHFFFAOYSA-N |
| XLogP | -4.00 |
| TPSA | 149.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|