C37H26Br2N4Ni — CID 58761697
dibromonickel;1-quinolin-2-yl-N-[(9R,10R)-10-(quinolin-2-ylmethylideneamino)-9-pentacyclo[9.6.0.01,8.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaenyl]methanimine (PubChem CID 58761697) has the molecular formula C37H26Br2N4Ni and a molecular weight of 745.14 g/mol. Its IUPAC name is dibromonickel;1-quinolin-2-yl-N-[(9R,10R)-10-(quinolin-2-ylmethylideneamino)-9-pentacyclo[9.6.0.01,8.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaenyl]methanimine.
| Compound Name | dibromonickel;1-quinolin-2-yl-N-[(9R,10R)-10-(quinolin-2-ylmethylideneamino)-9-pentacyclo[9.6.0.01,8.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaenyl]methanimine |
|---|---|
| PubChem CID | 58761697 |
| Molecular Formula | C37H26Br2N4Ni |
| Molecular Weight | 745.14 g/mol |
| Exact Mass | 741.99 |
| IUPAC Name | dibromonickel;1-quinolin-2-yl-N-[(9R,10R)-10-(quinolin-2-ylmethylideneamino)-9-pentacyclo[9.6.0.01,8.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaenyl]methanimine |
| SMILES | Br[Ni]Br.C(=N/[C@@H]1C2c3ccccc3C23c2ccccc2C3[C@H]1/N=C/c1ccc2ccccc2n1)\c1ccc2ccccc2n1 |
| InChI | InChI=1S/C37H26N4.2BrH.Ni/c1-7-15-31-23(9-1)17-19-25(40-31)21-38-35-33-27-11-3-5-13-29(27)37(33)30-14-6-4-12-28(30)34(37)36(35)39-22-26-20-18-24-10-2-8-16-32(24)41-26;;;/h1-22,33-36H;2*1H;/q;;;+2/p-2/b38-21+,39-22+;;;/t33?,34?,35-,36-,37?;;;/m1.../s1 |
| InChIKey | ZYXFVWREEHRDHE-HFCCHMLJSA-L |
| XLogP | 8.94 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.14 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|