C30H64O7SSi3 — CID 58761784
S-[[3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-(2-hydroxybutoxy)oxan-2-yl]methyl] ethanethioate (PubChem CID 58761784) has the molecular formula C30H64O7SSi3 and a molecular weight of 653.16 g/mol. Its IUPAC name is S-[[3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-(2-hydroxybutoxy)oxan-2-yl]methyl] ethanethioate.
| Compound Name | S-[[3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-(2-hydroxybutoxy)oxan-2-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 58761784 |
| Molecular Formula | C30H64O7SSi3 |
| Molecular Weight | 653.16 g/mol |
| Exact Mass | 652.37 |
| IUPAC Name | S-[[3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-(2-hydroxybutoxy)oxan-2-yl]methyl] ethanethioate |
| SMILES | CCC(O)COC1OC(CSC(C)=O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H64O7SSi3/c1-18-22(32)19-33-27-26(37-41(16,17)30(9,10)11)25(36-40(14,15)29(6,7)8)24(23(34-27)20-38-21(2)31)35-39(12,13)28(3,4)5/h22-27,32H,18-20H2,1-17H3 |
| InChIKey | OMLPEECAXAXZHS-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.16 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|