C23H21ClN6O2 — CID 58761926
7-chloro-2-[(E)-N-[4-(hydroxymethyl)phenyl]-N'-isocyanocarbamimidoyl]-6-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxamide (PubChem CID 58761926) has the molecular formula C23H21ClN6O2 and a molecular weight of 448.91 g/mol. Its IUPAC name is 7-chloro-2-[(E)-N-[4-(hydroxymethyl)phenyl]-N'-isocyanocarbamimidoyl]-6-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxamide.
| Compound Name | 7-chloro-2-[(E)-N-[4-(hydroxymethyl)phenyl]-N'-isocyanocarbamimidoyl]-6-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxamide |
|---|---|
| PubChem CID | 58761926 |
| Molecular Formula | C23H21ClN6O2 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 7-chloro-2-[(E)-N-[4-(hydroxymethyl)phenyl]-N'-isocyanocarbamimidoyl]-6-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxamide |
| SMILES | [C-]#[N+]/N=C(\Nc1ccc(CO)cc1)N1CCn2c(c(C(N)=O)c(Cl)c2-c2ccccc2)C1 |
| InChI | InChI=1S/C23H21ClN6O2/c1-26-28-23(27-17-9-7-15(14-31)8-10-17)29-11-12-30-18(13-29)19(22(25)32)20(24)21(30)16-5-3-2-4-6-16/h2-10,31H,11-14H2,(H2,25,32)(H,27,28) |
| InChIKey | STSDQLLYWVKNNJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|