C29H62O4Si2 — CID 58762115
(Z)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-methoxy-4,6,8,10-tetramethyldodec-2-en-1-ol (PubChem CID 58762115) has the molecular formula C29H62O4Si2 and a molecular weight of 530.98 g/mol. Its IUPAC name is (Z)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-methoxy-4,6,8,10-tetramethyldodec-2-en-1-ol.
| Compound Name | (Z)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-methoxy-4,6,8,10-tetramethyldodec-2-en-1-ol |
|---|---|
| PubChem CID | 58762115 |
| Molecular Formula | C29H62O4Si2 |
| Molecular Weight | 530.98 g/mol |
| Exact Mass | 530.42 |
| IUPAC Name | (Z)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-methoxy-4,6,8,10-tetramethyldodec-2-en-1-ol |
| SMILES | COC(C)C(C)C(O[Si](C)(C)C(C)(C)C)C(C)CC(C)C(O[Si](C)(C)C(C)(C)C)C(C)/C=C\CO |
| InChI | InChI=1S/C29H62O4Si2/c1-21(18-17-19-30)26(32-34(13,14)28(6,7)8)22(2)20-23(3)27(24(4)25(5)31-12)33-35(15,16)29(9,10)11/h17-18,21-27,30H,19-20H2,1-16H3/b18-17- |
| InChIKey | BZDSKDQJDJBVOH-ZCXUNETKSA-N |
| XLogP | 8.29 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.98 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|