C30H62O5Si2 — CID 58762130
methyl (Z)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-methoxy-4,6,8,10-tetramethyldodec-2-enoate (PubChem CID 58762130) has the molecular formula C30H62O5Si2 and a molecular weight of 558.99 g/mol. Its IUPAC name is methyl (Z)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-methoxy-4,6,8,10-tetramethyldodec-2-enoate.
| Compound Name | methyl (Z)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-methoxy-4,6,8,10-tetramethyldodec-2-enoate |
|---|---|
| PubChem CID | 58762130 |
| Molecular Formula | C30H62O5Si2 |
| Molecular Weight | 558.99 g/mol |
| Exact Mass | 558.41 |
| IUPAC Name | methyl (Z)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-methoxy-4,6,8,10-tetramethyldodec-2-enoate |
| SMILES | COC(=O)/C=C\C(C)C(O[Si](C)(C)C(C)(C)C)C(C)CC(C)C(O[Si](C)(C)C(C)(C)C)C(C)C(C)OC |
| InChI | InChI=1S/C30H62O5Si2/c1-21(18-19-26(31)33-13)27(34-36(14,15)29(6,7)8)22(2)20-23(3)28(24(4)25(5)32-12)35-37(16,17)30(9,10)11/h18-19,21-25,27-28H,20H2,1-17H3/b19-18- |
| InChIKey | YNNYSDCLEZMQNZ-HNENSFHCSA-N |
| XLogP | 8.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.99 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|