C26H58O4Si2 — CID 58762139
3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,8-tetramethyldecane-1,9-diol (PubChem CID 58762139) has the molecular formula C26H58O4Si2 and a molecular weight of 490.92 g/mol. Its IUPAC name is 3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,8-tetramethyldecane-1,9-diol.
| Compound Name | 3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,8-tetramethyldecane-1,9-diol |
|---|---|
| PubChem CID | 58762139 |
| Molecular Formula | C26H58O4Si2 |
| Molecular Weight | 490.92 g/mol |
| Exact Mass | 490.39 |
| IUPAC Name | 3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,8-tetramethyldecane-1,9-diol |
| SMILES | CC(O)C(C)C(O[Si](C)(C)C(C)(C)C)C(C)CC(C)C(O[Si](C)(C)C(C)(C)C)C(C)CO |
| InChI | InChI=1S/C26H58O4Si2/c1-18(23(20(3)17-27)29-31(12,13)25(6,7)8)16-19(2)24(21(4)22(5)28)30-32(14,15)26(9,10)11/h18-24,27-28H,16-17H2,1-15H3 |
| InChIKey | HZCMPVANARGYMN-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.92 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|