C26H56O4Si2 — CID 58762146
3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxy-2,4,6,8-tetramethyldecanal (PubChem CID 58762146) has the molecular formula C26H56O4Si2 and a molecular weight of 488.90 g/mol. Its IUPAC name is 3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxy-2,4,6,8-tetramethyldecanal.
| Compound Name | 3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxy-2,4,6,8-tetramethyldecanal |
|---|---|
| PubChem CID | 58762146 |
| Molecular Formula | C26H56O4Si2 |
| Molecular Weight | 488.90 g/mol |
| Exact Mass | 488.37 |
| IUPAC Name | 3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxy-2,4,6,8-tetramethyldecanal |
| SMILES | CC(O)C(C)C(O[Si](C)(C)C(C)(C)C)C(C)CC(C)C(O[Si](C)(C)C(C)(C)C)C(C)C=O |
| InChI | InChI=1S/C26H56O4Si2/c1-18(23(20(3)17-27)29-31(12,13)25(6,7)8)16-19(2)24(21(4)22(5)28)30-32(14,15)26(9,10)11/h17-24,28H,16H2,1-15H3 |
| InChIKey | PEQVFLWQOCQPSX-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.90 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|