C27H29F3N4O4 — CID 58762196
2-cyclopentyl-4-hydroxy-2-[2-[4-hydroxy-3-(2,2,2-trifluoroethyl)phenyl]ethyl]-5-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3H-pyran-6-one (PubChem CID 58762196) has the molecular formula C27H29F3N4O4 and a molecular weight of 530.55 g/mol. Its IUPAC name is 2-cyclopentyl-4-hydroxy-2-[2-[4-hydroxy-3-(2,2,2-trifluoroethyl)phenyl]ethyl]-5-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3H-pyran-6-one.
| Compound Name | 2-cyclopentyl-4-hydroxy-2-[2-[4-hydroxy-3-(2,2,2-trifluoroethyl)phenyl]ethyl]-5-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3H-pyran-6-one |
|---|---|
| PubChem CID | 58762196 |
| Molecular Formula | C27H29F3N4O4 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 2-cyclopentyl-4-hydroxy-2-[2-[4-hydroxy-3-(2,2,2-trifluoroethyl)phenyl]ethyl]-5-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3H-pyran-6-one |
| SMILES | Cc1cnc2nc(CC3=C(O)CC(CCc4ccc(O)c(CC(F)(F)F)c4)(C4CCCC4)OC3=O)nn2c1 |
| InChI | InChI=1S/C27H29F3N4O4/c1-16-14-31-25-32-23(33-34(25)15-16)11-20-22(36)13-26(38-24(20)37,19-4-2-3-5-19)9-8-17-6-7-21(35)18(10-17)12-27(28,29)30/h6-7,10,14-15,19,35-36H,2-5,8-9,11-13H2,1H3 |
| InChIKey | MGUXCFKNOGONOB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 109.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |