C10H13BrN2O — CID 58762667
1-[(1R)-1-(4-bromophenyl)ethyl]-3-methylurea (PubChem CID 58762667) has the molecular formula C10H13BrN2O and a molecular weight of 257.13 g/mol. Its IUPAC name is 1-[(1R)-1-(4-bromophenyl)ethyl]-3-methylurea.
| Compound Name | 1-[(1R)-1-(4-bromophenyl)ethyl]-3-methylurea |
|---|---|
| PubChem CID | 58762667 |
| Molecular Formula | C10H13BrN2O |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 1-[(1R)-1-(4-bromophenyl)ethyl]-3-methylurea |
| SMILES | CNC(=O)N[C@H](C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H13BrN2O/c1-7(13-10(14)12-2)8-3-5-9(11)6-4-8/h3-7H,1-2H3,(H2,12,13,14)/t7-/m1/s1 |
| InChIKey | RCXUOOMQPYJXNO-SSDOTTSWSA-N |
| XLogP | 2.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |