C14H18F3NO4 — CID 58762776
N-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2,2,2-trifluoroacetamide (PubChem CID 58762776) has the molecular formula C14H18F3NO4 and a molecular weight of 321.30 g/mol. Its IUPAC name is N-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 58762776 |
| Molecular Formula | C14H18F3NO4 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1CC(=O)OC(CCNC(=O)C(F)(F)F)(C2CCCC2)C1 |
| InChI | InChI=1S/C14H18F3NO4/c15-14(16,17)12(21)18-6-5-13(9-3-1-2-4-9)8-10(19)7-11(20)22-13/h9H,1-8H2,(H,18,21) |
| InChIKey | ULIXCBWZLRQFML-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|