C13H12ClIN6O — CID 58762793
4-chloro-1-[(4-iodo-3,5-dimethyl-1-oxidopyridin-1-ium-2-yl)methyl]pyrazolo[5,4-d]pyrimidin-6-amine (PubChem CID 58762793) has the molecular formula C13H12ClIN6O and a molecular weight of 430.64 g/mol. Its IUPAC name is 4-chloro-1-[(4-iodo-3,5-dimethyl-1-oxidopyridin-1-ium-2-yl)methyl]pyrazolo[5,4-d]pyrimidin-6-amine.
| Compound Name | 4-chloro-1-[(4-iodo-3,5-dimethyl-1-oxidopyridin-1-ium-2-yl)methyl]pyrazolo[5,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 58762793 |
| Molecular Formula | C13H12ClIN6O |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | 4-chloro-1-[(4-iodo-3,5-dimethyl-1-oxidopyridin-1-ium-2-yl)methyl]pyrazolo[5,4-d]pyrimidin-6-amine |
| SMILES | Cc1c[n+]([O-])c(Cn2ncc3c(Cl)nc(N)nc32)c(C)c1I |
| InChI | InChI=1S/C13H12ClIN6O/c1-6-4-21(22)9(7(2)10(6)15)5-20-12-8(3-17-20)11(14)18-13(16)19-12/h3-4H,5H2,1-2H3,(H2,16,18,19) |
| InChIKey | XZRVMHDAQGSRSN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 96.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|