C15H17ClN6O3 — CID 58762824
4-chloro-1-[(4,6-dimethoxy-3,5-dimethyl-1-oxidopyridin-1-ium-2-yl)methyl]pyrazolo[5,4-d]pyrimidin-6-amine (PubChem CID 58762824) has the molecular formula C15H17ClN6O3 and a molecular weight of 364.79 g/mol. Its IUPAC name is 4-chloro-1-[(4,6-dimethoxy-3,5-dimethyl-1-oxidopyridin-1-ium-2-yl)methyl]pyrazolo[5,4-d]pyrimidin-6-amine.
| Compound Name | 4-chloro-1-[(4,6-dimethoxy-3,5-dimethyl-1-oxidopyridin-1-ium-2-yl)methyl]pyrazolo[5,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 58762824 |
| Molecular Formula | C15H17ClN6O3 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 4-chloro-1-[(4,6-dimethoxy-3,5-dimethyl-1-oxidopyridin-1-ium-2-yl)methyl]pyrazolo[5,4-d]pyrimidin-6-amine |
| SMILES | COc1c(C)c(Cn2ncc3c(Cl)nc(N)nc32)[n+]([O-])c(OC)c1C |
| InChI | InChI=1S/C15H17ClN6O3/c1-7-10(22(23)14(25-4)8(2)11(7)24-3)6-21-13-9(5-18-21)12(16)19-15(17)20-13/h5H,6H2,1-4H3,(H2,17,19,20) |
| InChIKey | PPVGIYYBSSUJAZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|