About 5-chloro-6-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanyl]-1H-quinolin-2-one
5-chloro-6-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanyl]-1H-quinolin-2-one (PubChem CID 58762868) has the molecular formula C17H19ClN2OS
and a molecular weight of 334.87 g/mol. Its IUPAC name is 5-chloro-6-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanyl]-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 5-chloro-6-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanyl]-1H-quinolin-2-one |
| PubChem CID | 58762868 |
| Molecular Formula | C17H19ClN2OS |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 5-chloro-6-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanyl]-1H-quinolin-2-one |
| SMILES | CN1[C@@H]2CC[C@H]1CC(Sc1ccc3[nH]c(=O)ccc3c1Cl)C2 |
| InChI | InChI=1S/C17H19ClN2OS/c1-20-10-2-3-11(20)9-12(8-10)22-15-6-5-14-13(17(15)18)4-7-16(21)19-14/h4-7,10-12H,2-3,8-9H2,1H3,(H,19,21)/t10-,11+,12? |
| InChIKey | DXUJOFOCIUVOOS-FOSCPWQOSA-N |
| XLogP | 3.90 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-6-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanyl]-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanyl]-1H-quinolin-2-one?
The IUPAC name of 5-chloro-6-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanyl]-1H-quinolin-2-one (CID 58762868) is 5-chloro-6-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanyl]-1H-quinolin-2-one.
What is the SMILES notation for 5-chloro-6-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanyl]-1H-quinolin-2-one?
The canonical SMILES for 5-chloro-6-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanyl]-1H-quinolin-2-one is CN1[C@@H]2CC[C@H]1CC(Sc1ccc3[nH]c(=O)ccc3c1Cl)C2.
What is the InChIKey of 5-chloro-6-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanyl]-1H-quinolin-2-one?
The InChIKey is DXUJOFOCIUVOOS-FOSCPWQOSA-N. The full InChI is InChI=1S/C17H19ClN2OS/c1-20-10-2-3-11(20)9-12(8-10)22-15-6-5-14-13(17(15)18)4-7-16(21)19-14/h4-7,10-12H,2-3,8-9H2,1H3,(H,19,21)/t10-,11+,12?.
What are the key properties of 5-chloro-6-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanyl]-1H-quinolin-2-one?
5-chloro-6-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanyl]-1H-quinolin-2-one has a molecular weight of 334.87 g/mol, XLogP of 3.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanyl]-1H-quinolin-2-one is sourced from PubChem (CID 58762868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).