About 7-methyl-2-oxo-3H-1,3-benzoxazole-6-sulfonic acid
7-methyl-2-oxo-3H-1,3-benzoxazole-6-sulfonic acid (PubChem CID 58762874) has the molecular formula C8H7NO5S
and a molecular weight of 229.21 g/mol. Its IUPAC name is 7-methyl-2-oxo-3H-1,3-benzoxazole-6-sulfonic acid.
Molecular Properties
| Compound Name | 7-methyl-2-oxo-3H-1,3-benzoxazole-6-sulfonic acid |
| PubChem CID | 58762874 |
| Molecular Formula | C8H7NO5S |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 7-methyl-2-oxo-3H-1,3-benzoxazole-6-sulfonic acid |
| SMILES | Cc1c(S(=O)(=O)O)ccc2[nH]c(=O)oc12 |
| InChI | InChI=1S/C8H7NO5S/c1-4-6(15(11,12)13)3-2-5-7(4)14-8(10)9-5/h2-3H,1H3,(H,9,10)(H,11,12,13) |
| InChIKey | MPFOPHUFDFJTQJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-2-oxo-3H-1,3-benzoxazole-6-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2-oxo-3H-1,3-benzoxazole-6-sulfonic acid?
The IUPAC name of 7-methyl-2-oxo-3H-1,3-benzoxazole-6-sulfonic acid (CID 58762874) is 7-methyl-2-oxo-3H-1,3-benzoxazole-6-sulfonic acid.
What is the SMILES notation for 7-methyl-2-oxo-3H-1,3-benzoxazole-6-sulfonic acid?
The canonical SMILES for 7-methyl-2-oxo-3H-1,3-benzoxazole-6-sulfonic acid is Cc1c(S(=O)(=O)O)ccc2[nH]c(=O)oc12.
What is the InChIKey of 7-methyl-2-oxo-3H-1,3-benzoxazole-6-sulfonic acid?
The InChIKey is MPFOPHUFDFJTQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO5S/c1-4-6(15(11,12)13)3-2-5-7(4)14-8(10)9-5/h2-3H,1H3,(H,9,10)(H,11,12,13).
What are the key properties of 7-methyl-2-oxo-3H-1,3-benzoxazole-6-sulfonic acid?
7-methyl-2-oxo-3H-1,3-benzoxazole-6-sulfonic acid has a molecular weight of 229.21 g/mol, XLogP of 0.68, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2-oxo-3H-1,3-benzoxazole-6-sulfonic acid is sourced from PubChem (CID 58762874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).