About 2,3-di(propan-2-yl)-1,3,5-triazepine
2,3-di(propan-2-yl)-1,3,5-triazepine (PubChem CID 58762912) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)-1,3,5-triazepine.
Molecular Properties
| Compound Name | 2,3-di(propan-2-yl)-1,3,5-triazepine |
| PubChem CID | 58762912 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 2,3-di(propan-2-yl)-1,3,5-triazepine |
| SMILES | CC(C)C1=NC=CN=CN1C(C)C |
| InChI | InChI=1S/C10H17N3/c1-8(2)10-12-6-5-11-7-13(10)9(3)4/h5-9H,1-4H3 |
| InChIKey | WBXAZVCBKYHCSQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-di(propan-2-yl)-1,3,5-triazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(propan-2-yl)-1,3,5-triazepine?
The IUPAC name of 2,3-di(propan-2-yl)-1,3,5-triazepine (CID 58762912) is 2,3-di(propan-2-yl)-1,3,5-triazepine.
What is the SMILES notation for 2,3-di(propan-2-yl)-1,3,5-triazepine?
The canonical SMILES for 2,3-di(propan-2-yl)-1,3,5-triazepine is CC(C)C1=NC=CN=CN1C(C)C.
What is the InChIKey of 2,3-di(propan-2-yl)-1,3,5-triazepine?
The InChIKey is WBXAZVCBKYHCSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-8(2)10-12-6-5-11-7-13(10)9(3)4/h5-9H,1-4H3.
What are the key properties of 2,3-di(propan-2-yl)-1,3,5-triazepine?
2,3-di(propan-2-yl)-1,3,5-triazepine has a molecular weight of 179.27 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(propan-2-yl)-1,3,5-triazepine is sourced from PubChem (CID 58762912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).