About 2-methyl-4,5-di(propan-2-yl)-3H-thiophen-3-ide;yttrium
2-methyl-4,5-di(propan-2-yl)-3H-thiophen-3-ide;yttrium (PubChem CID 58762996) has the molecular formula C11H17SY-
and a molecular weight of 270.23 g/mol. Its IUPAC name is 2-methyl-4,5-di(propan-2-yl)-3H-thiophen-3-ide;yttrium.
Molecular Properties
| Compound Name | 2-methyl-4,5-di(propan-2-yl)-3H-thiophen-3-ide;yttrium |
| PubChem CID | 58762996 |
| Molecular Formula | C11H17SY- |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 2-methyl-4,5-di(propan-2-yl)-3H-thiophen-3-ide;yttrium |
| SMILES | Cc1[c-]c(C(C)C)c(C(C)C)s1.[Y] |
| InChI | InChI=1S/C11H17S.Y/c1-7(2)10-6-9(5)12-11(10)8(3)4;/h7-8H,1-5H3;/q-1; |
| InChIKey | ODTXQTNLWQVFPH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4,5-di(propan-2-yl)-3H-thiophen-3-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5-di(propan-2-yl)-3H-thiophen-3-ide;yttrium?
The IUPAC name of 2-methyl-4,5-di(propan-2-yl)-3H-thiophen-3-ide;yttrium (CID 58762996) is 2-methyl-4,5-di(propan-2-yl)-3H-thiophen-3-ide;yttrium.
What is the SMILES notation for 2-methyl-4,5-di(propan-2-yl)-3H-thiophen-3-ide;yttrium?
The canonical SMILES for 2-methyl-4,5-di(propan-2-yl)-3H-thiophen-3-ide;yttrium is Cc1[c-]c(C(C)C)c(C(C)C)s1.[Y].
What is the InChIKey of 2-methyl-4,5-di(propan-2-yl)-3H-thiophen-3-ide;yttrium?
The InChIKey is ODTXQTNLWQVFPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17S.Y/c1-7(2)10-6-9(5)12-11(10)8(3)4;/h7-8H,1-5H3;/q-1;.
What are the key properties of 2-methyl-4,5-di(propan-2-yl)-3H-thiophen-3-ide;yttrium?
2-methyl-4,5-di(propan-2-yl)-3H-thiophen-3-ide;yttrium has a molecular weight of 270.23 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5-di(propan-2-yl)-3H-thiophen-3-ide;yttrium is sourced from PubChem (CID 58762996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).