C12H20N2 — CID 58763032
(5Z,7Z)-1,2-di(propan-2-yl)-4H-1,3-diazocine (PubChem CID 58763032) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (5Z,7Z)-1,2-di(propan-2-yl)-4H-1,3-diazocine.
| Compound Name | (5Z,7Z)-1,2-di(propan-2-yl)-4H-1,3-diazocine |
|---|---|
| PubChem CID | 58763032 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (5Z,7Z)-1,2-di(propan-2-yl)-4H-1,3-diazocine |
| SMILES | CC(C)/C1=N/C/C=C\C=C/N1C(C)C |
| InChI | InChI=1S/C12H20N2/c1-10(2)12-13-8-6-5-7-9-14(12)11(3)4/h5-7,9-11H,8H2,1-4H3/b6-5-,9-7-,13-12- |
| InChIKey | NXFBONHTNOGRLW-IBOLHTPYSA-N |
| XLogP | 2.83 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |