About 3-methoxyfuro[3,2-b]pyridine-2-carbohydrazide
3-methoxyfuro[3,2-b]pyridine-2-carbohydrazide (PubChem CID 58763037) has the molecular formula C9H9N3O3
and a molecular weight of 207.19 g/mol. Its IUPAC name is 3-methoxyfuro[3,2-b]pyridine-2-carbohydrazide.
Molecular Properties
| Compound Name | 3-methoxyfuro[3,2-b]pyridine-2-carbohydrazide |
| PubChem CID | 58763037 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 3-methoxyfuro[3,2-b]pyridine-2-carbohydrazide |
| SMILES | COc1c(C(=O)NN)oc2cccnc12 |
| InChI | InChI=1S/C9H9N3O3/c1-14-7-6-5(3-2-4-11-6)15-8(7)9(13)12-10/h2-4H,10H2,1H3,(H,12,13) |
| InChIKey | BUPPFHOWBDFJOW-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxyfuro[3,2-b]pyridine-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxyfuro[3,2-b]pyridine-2-carbohydrazide?
The IUPAC name of 3-methoxyfuro[3,2-b]pyridine-2-carbohydrazide (CID 58763037) is 3-methoxyfuro[3,2-b]pyridine-2-carbohydrazide.
What is the SMILES notation for 3-methoxyfuro[3,2-b]pyridine-2-carbohydrazide?
The canonical SMILES for 3-methoxyfuro[3,2-b]pyridine-2-carbohydrazide is COc1c(C(=O)NN)oc2cccnc12.
What is the InChIKey of 3-methoxyfuro[3,2-b]pyridine-2-carbohydrazide?
The InChIKey is BUPPFHOWBDFJOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O3/c1-14-7-6-5(3-2-4-11-6)15-8(7)9(13)12-10/h2-4H,10H2,1H3,(H,12,13).
What are the key properties of 3-methoxyfuro[3,2-b]pyridine-2-carbohydrazide?
3-methoxyfuro[3,2-b]pyridine-2-carbohydrazide has a molecular weight of 207.19 g/mol, XLogP of 0.44, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxyfuro[3,2-b]pyridine-2-carbohydrazide is sourced from PubChem (CID 58763037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).