About 6-methyl-3,4-di(propan-2-yl)-2,5-dihydro-1H-pyridin-5-ide;yttrium
6-methyl-3,4-di(propan-2-yl)-2,5-dihydro-1H-pyridin-5-ide;yttrium (PubChem CID 58763134) has the molecular formula C12H20NY-
and a molecular weight of 267.20 g/mol. Its IUPAC name is 6-methyl-3,4-di(propan-2-yl)-2,5-dihydro-1H-pyridin-5-ide;yttrium.
Molecular Properties
| Compound Name | 6-methyl-3,4-di(propan-2-yl)-2,5-dihydro-1H-pyridin-5-ide;yttrium |
| PubChem CID | 58763134 |
| Molecular Formula | C12H20NY- |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 6-methyl-3,4-di(propan-2-yl)-2,5-dihydro-1H-pyridin-5-ide;yttrium |
| SMILES | CC1=[C-]C(C(C)C)=C(C(C)C)CN1.[Y] |
| InChI | InChI=1S/C12H20N.Y/c1-8(2)11-6-10(5)13-7-12(11)9(3)4;/h8-9,13H,7H2,1-5H3;/q-1; |
| InChIKey | VBOYGADSLZPUCC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-3,4-di(propan-2-yl)-2,5-dihydro-1H-pyridin-5-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3,4-di(propan-2-yl)-2,5-dihydro-1H-pyridin-5-ide;yttrium?
The IUPAC name of 6-methyl-3,4-di(propan-2-yl)-2,5-dihydro-1H-pyridin-5-ide;yttrium (CID 58763134) is 6-methyl-3,4-di(propan-2-yl)-2,5-dihydro-1H-pyridin-5-ide;yttrium.
What is the SMILES notation for 6-methyl-3,4-di(propan-2-yl)-2,5-dihydro-1H-pyridin-5-ide;yttrium?
The canonical SMILES for 6-methyl-3,4-di(propan-2-yl)-2,5-dihydro-1H-pyridin-5-ide;yttrium is CC1=[C-]C(C(C)C)=C(C(C)C)CN1.[Y].
What is the InChIKey of 6-methyl-3,4-di(propan-2-yl)-2,5-dihydro-1H-pyridin-5-ide;yttrium?
The InChIKey is VBOYGADSLZPUCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N.Y/c1-8(2)11-6-10(5)13-7-12(11)9(3)4;/h8-9,13H,7H2,1-5H3;/q-1;.
What are the key properties of 6-methyl-3,4-di(propan-2-yl)-2,5-dihydro-1H-pyridin-5-ide;yttrium?
6-methyl-3,4-di(propan-2-yl)-2,5-dihydro-1H-pyridin-5-ide;yttrium has a molecular weight of 267.20 g/mol, XLogP of 2.90, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3,4-di(propan-2-yl)-2,5-dihydro-1H-pyridin-5-ide;yttrium is sourced from PubChem (CID 58763134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).