About 5,6-di(propan-2-yl)-2H-1,4-diazepine
5,6-di(propan-2-yl)-2H-1,4-diazepine (PubChem CID 58763146) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 5,6-di(propan-2-yl)-2H-1,4-diazepine.
Molecular Properties
| Compound Name | 5,6-di(propan-2-yl)-2H-1,4-diazepine |
| PubChem CID | 58763146 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 5,6-di(propan-2-yl)-2H-1,4-diazepine |
| SMILES | CC(C)C1=C(C(C)C)N=CCN=C1 |
| InChI | InChI=1S/C11H18N2/c1-8(2)10-7-12-5-6-13-11(10)9(3)4/h6-9H,5H2,1-4H3 |
| InChIKey | MBUIDMHMOCKWTC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-di(propan-2-yl)-2H-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-di(propan-2-yl)-2H-1,4-diazepine?
The IUPAC name of 5,6-di(propan-2-yl)-2H-1,4-diazepine (CID 58763146) is 5,6-di(propan-2-yl)-2H-1,4-diazepine.
What is the SMILES notation for 5,6-di(propan-2-yl)-2H-1,4-diazepine?
The canonical SMILES for 5,6-di(propan-2-yl)-2H-1,4-diazepine is CC(C)C1=C(C(C)C)N=CCN=C1.
What is the InChIKey of 5,6-di(propan-2-yl)-2H-1,4-diazepine?
The InChIKey is MBUIDMHMOCKWTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-8(2)10-7-12-5-6-13-11(10)9(3)4/h6-9H,5H2,1-4H3.
What are the key properties of 5,6-di(propan-2-yl)-2H-1,4-diazepine?
5,6-di(propan-2-yl)-2H-1,4-diazepine has a molecular weight of 178.28 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-di(propan-2-yl)-2H-1,4-diazepine is sourced from PubChem (CID 58763146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).