C11H19N3 — CID 58763159
(7Z)-3,4-di(propan-2-yl)-6H-1,3,5-triazocine (PubChem CID 58763159) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (7Z)-3,4-di(propan-2-yl)-6H-1,3,5-triazocine.
| Compound Name | (7Z)-3,4-di(propan-2-yl)-6H-1,3,5-triazocine |
|---|---|
| PubChem CID | 58763159 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (7Z)-3,4-di(propan-2-yl)-6H-1,3,5-triazocine |
| SMILES | CC(C)/C1=N/C/C=C\N=C/N1C(C)C |
| InChI | InChI=1S/C11H19N3/c1-9(2)11-13-7-5-6-12-8-14(11)10(3)4/h5-6,8-10H,7H2,1-4H3/b6-5-,12-8-,13-11- |
| InChIKey | JPKMQEOLIBOXIW-JBXCVXTRSA-N |
| XLogP | 2.31 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |