About [(1R,3R)-3-prop-2-enylcyclohexyl] acetate
[(1R,3R)-3-prop-2-enylcyclohexyl] acetate (PubChem CID 58763391) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is [(1R,3R)-3-prop-2-enylcyclohexyl] acetate.
Molecular Properties
| Compound Name | [(1R,3R)-3-prop-2-enylcyclohexyl] acetate |
| PubChem CID | 58763391 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | [(1R,3R)-3-prop-2-enylcyclohexyl] acetate |
| SMILES | C=CC[C@H]1CCC[C@@H](OC(C)=O)C1 |
| InChI | InChI=1S/C11H18O2/c1-3-5-10-6-4-7-11(8-10)13-9(2)12/h3,10-11H,1,4-8H2,2H3/t10-,11+/m0/s1 |
| InChIKey | PJDUHCFRNPOYSH-WDEREUQCSA-N |
| XLogP | 2.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,3R)-3-prop-2-enylcyclohexyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,3R)-3-prop-2-enylcyclohexyl] acetate?
The IUPAC name of [(1R,3R)-3-prop-2-enylcyclohexyl] acetate (CID 58763391) is [(1R,3R)-3-prop-2-enylcyclohexyl] acetate.
What is the SMILES notation for [(1R,3R)-3-prop-2-enylcyclohexyl] acetate?
The canonical SMILES for [(1R,3R)-3-prop-2-enylcyclohexyl] acetate is C=CC[C@H]1CCC[C@@H](OC(C)=O)C1.
What is the InChIKey of [(1R,3R)-3-prop-2-enylcyclohexyl] acetate?
The InChIKey is PJDUHCFRNPOYSH-WDEREUQCSA-N. The full InChI is InChI=1S/C11H18O2/c1-3-5-10-6-4-7-11(8-10)13-9(2)12/h3,10-11H,1,4-8H2,2H3/t10-,11+/m0/s1.
What are the key properties of [(1R,3R)-3-prop-2-enylcyclohexyl] acetate?
[(1R,3R)-3-prop-2-enylcyclohexyl] acetate has a molecular weight of 182.26 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,3R)-3-prop-2-enylcyclohexyl] acetate is sourced from PubChem (CID 58763391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).