C23H18O4S2 — CID 58763441
3,4-bis[(4-methoxyphenyl)sulfanyl]chromen-2-one (PubChem CID 58763441) has the molecular formula C23H18O4S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 3,4-bis[(4-methoxyphenyl)sulfanyl]chromen-2-one.
| Compound Name | 3,4-bis[(4-methoxyphenyl)sulfanyl]chromen-2-one |
|---|---|
| PubChem CID | 58763441 |
| Molecular Formula | C23H18O4S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 3,4-bis[(4-methoxyphenyl)sulfanyl]chromen-2-one |
| SMILES | COc1ccc(Sc2c(Sc3ccc(OC)cc3)c3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C23H18O4S2/c1-25-15-7-11-17(12-8-15)28-21-19-5-3-4-6-20(19)27-23(24)22(21)29-18-13-9-16(26-2)10-14-18/h3-14H,1-2H3 |
| InChIKey | ZXRDKLQHNUXHNI-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|