C46H88N2O4+2 — CID 58763461
2-[[(6R)-3,4-dihexyl-5-[(Z)-[2-[2-(trimethylazaniumyl)ethylperoxymethyl]cyclooctylidene]methyl]spiro[5.7]tridec-1-en-13-yl]methylperoxy]ethyl-trimethylazanium (PubChem CID 58763461) has the molecular formula C46H88N2O4+2 and a molecular weight of 733.22 g/mol. Its IUPAC name is 2-[[(6R)-3,4-dihexyl-5-[(Z)-[2-[2-(trimethylazaniumyl)ethylperoxymethyl]cyclooctylidene]methyl]spiro[5.7]tridec-1-en-13-yl]methylperoxy]ethyl-trimethylazanium.
| Compound Name | 2-[[(6R)-3,4-dihexyl-5-[(Z)-[2-[2-(trimethylazaniumyl)ethylperoxymethyl]cyclooctylidene]methyl]spiro[5.7]tridec-1-en-13-yl]methylperoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 58763461 |
| Molecular Formula | C46H88N2O4+2 |
| Molecular Weight | 733.22 g/mol |
| Exact Mass | 732.67 |
| IUPAC Name | 2-[[(6R)-3,4-dihexyl-5-[(Z)-[2-[2-(trimethylazaniumyl)ethylperoxymethyl]cyclooctylidene]methyl]spiro[5.7]tridec-1-en-13-yl]methylperoxy]ethyl-trimethylazanium |
| SMILES | CCCCCCC1C=C[C@]2(CCCCCCC2COOCC[N+](C)(C)C)C(/C=C2/CCCCCCC2COOCC[N+](C)(C)C)C1CCCCCC |
| InChI | InChI=1S/C46H88N2O4/c1-9-11-13-19-25-40-30-32-46(31-24-18-17-22-28-43(46)39-52-50-36-34-48(6,7)8)45(44(40)29-23-14-12-10-2)37-41-26-20-15-16-21-27-42(41)38-51-49-35-33-47(3,4)5/h30,32,37,40,42-45H,9-29,31,33-36,38-39H2,1-8H3/q+2/b41-37-/t40?,42?,43?,44?,45?,46-/m0/s1 |
| InChIKey | RGUBGXQWLKUKTH-FJJNAEHHSA-N |
| XLogP | 11.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.22 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|