About 4,4-dimethyl-6-methylidene-3,5-dihydro-2H-pyran-3-ide;bis(yttrium)
4,4-dimethyl-6-methylidene-3,5-dihydro-2H-pyran-3-ide;bis(yttrium) (PubChem CID 58763808) has the molecular formula C8H13OY2-
and a molecular weight of 303.00 g/mol. Its IUPAC name is 4,4-dimethyl-6-methylidene-3,5-dihydro-2H-pyran-3-ide;bis(yttrium).
Molecular Properties
| Compound Name | 4,4-dimethyl-6-methylidene-3,5-dihydro-2H-pyran-3-ide;bis(yttrium) |
| PubChem CID | 58763808 |
| Molecular Formula | C8H13OY2- |
| Molecular Weight | 303.00 g/mol |
| Exact Mass | 302.91 |
| IUPAC Name | 4,4-dimethyl-6-methylidene-3,5-dihydro-2H-pyran-3-ide;bis(yttrium) |
| SMILES | C=C1CC(C)(C)[CH-]CO1.[Y].[Y] |
| InChI | InChI=1S/C8H13O.2Y/c1-7-6-8(2,3)4-5-9-7;;/h4H,1,5-6H2,2-3H3;;/q-1;; |
| InChIKey | ZQUBAUSPWIQGJH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.00 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-6-methylidene-3,5-dihydro-2H-pyran-3-ide;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-6-methylidene-3,5-dihydro-2H-pyran-3-ide;bis(yttrium)?
The IUPAC name of 4,4-dimethyl-6-methylidene-3,5-dihydro-2H-pyran-3-ide;bis(yttrium) (CID 58763808) is 4,4-dimethyl-6-methylidene-3,5-dihydro-2H-pyran-3-ide;bis(yttrium).
What is the SMILES notation for 4,4-dimethyl-6-methylidene-3,5-dihydro-2H-pyran-3-ide;bis(yttrium)?
The canonical SMILES for 4,4-dimethyl-6-methylidene-3,5-dihydro-2H-pyran-3-ide;bis(yttrium) is C=C1CC(C)(C)[CH-]CO1.[Y].[Y].
What is the InChIKey of 4,4-dimethyl-6-methylidene-3,5-dihydro-2H-pyran-3-ide;bis(yttrium)?
The InChIKey is ZQUBAUSPWIQGJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13O.2Y/c1-7-6-8(2,3)4-5-9-7;;/h4H,1,5-6H2,2-3H3;;/q-1;;.
What are the key properties of 4,4-dimethyl-6-methylidene-3,5-dihydro-2H-pyran-3-ide;bis(yttrium)?
4,4-dimethyl-6-methylidene-3,5-dihydro-2H-pyran-3-ide;bis(yttrium) has a molecular weight of 303.00 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-6-methylidene-3,5-dihydro-2H-pyran-3-ide;bis(yttrium) is sourced from PubChem (CID 58763808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).