C11H19OY2- — CID 58763811
4-(2,2-dimethylbutyl)-2-methylideneoxolane;bis(yttrium) (PubChem CID 58763811) has the molecular formula C11H19OY2- and a molecular weight of 345.08 g/mol. Its IUPAC name is 4-(2,2-dimethylbutyl)-2-methylideneoxolane;bis(yttrium).
| Compound Name | 4-(2,2-dimethylbutyl)-2-methylideneoxolane;bis(yttrium) |
|---|---|
| PubChem CID | 58763811 |
| Molecular Formula | C11H19OY2- |
| Molecular Weight | 345.08 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | 4-(2,2-dimethylbutyl)-2-methylideneoxolane;bis(yttrium) |
| SMILES | C=C1CC(CC(C)(C)[CH-]C)CO1.[Y].[Y] |
| InChI | InChI=1S/C11H19O.2Y/c1-5-11(3,4)7-10-6-9(2)12-8-10;;/h5,10H,2,6-8H2,1,3-4H3;;/q-1;; |
| InChIKey | ALAVZVKLQUIQOJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.08 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|