About 3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-1,3-benzoxazole-2-thione
3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-1,3-benzoxazole-2-thione (PubChem CID 58763817) has the molecular formula C20H23NO2S
and a molecular weight of 341.48 g/mol. Its IUPAC name is 3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-1,3-benzoxazole-2-thione.
Molecular Properties
| Compound Name | 3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-1,3-benzoxazole-2-thione |
| PubChem CID | 58763817 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-1,3-benzoxazole-2-thione |
| SMILES | CC(C)c1cc(Cn2c(=S)oc3ccccc32)cc(C(C)C)c1O |
| InChI | InChI=1S/C20H23NO2S/c1-12(2)15-9-14(10-16(13(3)4)19(15)22)11-21-17-7-5-6-8-18(17)23-20(21)24/h5-10,12-13,22H,11H2,1-4H3 |
| InChIKey | ANVRIUUKRIXGPV-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 38.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-1,3-benzoxazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-1,3-benzoxazole-2-thione?
The IUPAC name of 3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-1,3-benzoxazole-2-thione (CID 58763817) is 3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-1,3-benzoxazole-2-thione.
What is the SMILES notation for 3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-1,3-benzoxazole-2-thione?
The canonical SMILES for 3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-1,3-benzoxazole-2-thione is CC(C)c1cc(Cn2c(=S)oc3ccccc32)cc(C(C)C)c1O.
What is the InChIKey of 3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-1,3-benzoxazole-2-thione?
The InChIKey is ANVRIUUKRIXGPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO2S/c1-12(2)15-9-14(10-16(13(3)4)19(15)22)11-21-17-7-5-6-8-18(17)23-20(21)24/h5-10,12-13,22H,11H2,1-4H3.
What are the key properties of 3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-1,3-benzoxazole-2-thione?
3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-1,3-benzoxazole-2-thione has a molecular weight of 341.48 g/mol, XLogP of 5.96, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-1,3-benzoxazole-2-thione is sourced from PubChem (CID 58763817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).