About N-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenyl]methanesulfonamide
N-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenyl]methanesulfonamide (PubChem CID 58764030) has the molecular formula C21H29NO5S
and a molecular weight of 407.53 g/mol. Its IUPAC name is N-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenyl]methanesulfonamide |
| PubChem CID | 58764030 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenyl]methanesulfonamide |
| SMILES | CCc1cc(CCC2(C3CCCC3)CC(=O)CC(=O)O2)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C21H29NO5S/c1-3-16-12-15(8-9-19(16)22-28(2,25)26)10-11-21(17-6-4-5-7-17)14-18(23)13-20(24)27-21/h8-9,12,17,22H,3-7,10-11,13-14H2,1-2H3 |
| InChIKey | IDABZXWSPLBAPE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenyl]methanesulfonamide?
The IUPAC name of N-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenyl]methanesulfonamide (CID 58764030) is N-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenyl]methanesulfonamide.
What is the SMILES notation for N-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenyl]methanesulfonamide?
The canonical SMILES for N-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenyl]methanesulfonamide is CCc1cc(CCC2(C3CCCC3)CC(=O)CC(=O)O2)ccc1NS(C)(=O)=O.
What is the InChIKey of N-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenyl]methanesulfonamide?
The InChIKey is IDABZXWSPLBAPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO5S/c1-3-16-12-15(8-9-19(16)22-28(2,25)26)10-11-21(17-6-4-5-7-17)14-18(23)13-20(24)27-21/h8-9,12,17,22H,3-7,10-11,13-14H2,1-2H3.
What are the key properties of N-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenyl]methanesulfonamide?
N-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenyl]methanesulfonamide has a molecular weight of 407.53 g/mol, XLogP of 3.39, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-ethylphenyl]methanesulfonamide is sourced from PubChem (CID 58764030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).