About imidazo[1,2-b][1,2,4]triazine-6-carbaldehyde
imidazo[1,2-b][1,2,4]triazine-6-carbaldehyde (PubChem CID 58764268) has the molecular formula C6H4N4O
and a molecular weight of 148.12 g/mol. Its IUPAC name is imidazo[1,2-b][1,2,4]triazine-6-carbaldehyde.
Molecular Properties
| Compound Name | imidazo[1,2-b][1,2,4]triazine-6-carbaldehyde |
| PubChem CID | 58764268 |
| Molecular Formula | C6H4N4O |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | imidazo[1,2-b][1,2,4]triazine-6-carbaldehyde |
| SMILES | O=Cc1cn2nccnc2n1 |
| InChI | InChI=1S/C6H4N4O/c11-4-5-3-10-6(9-5)7-1-2-8-10/h1-4H |
| InChIKey | WWMSYJROIXMNJC-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze imidazo[1,2-b][1,2,4]triazine-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-b][1,2,4]triazine-6-carbaldehyde?
The IUPAC name of imidazo[1,2-b][1,2,4]triazine-6-carbaldehyde (CID 58764268) is imidazo[1,2-b][1,2,4]triazine-6-carbaldehyde.
What is the SMILES notation for imidazo[1,2-b][1,2,4]triazine-6-carbaldehyde?
The canonical SMILES for imidazo[1,2-b][1,2,4]triazine-6-carbaldehyde is O=Cc1cn2nccnc2n1.
What is the InChIKey of imidazo[1,2-b][1,2,4]triazine-6-carbaldehyde?
The InChIKey is WWMSYJROIXMNJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O/c11-4-5-3-10-6(9-5)7-1-2-8-10/h1-4H.
What are the key properties of imidazo[1,2-b][1,2,4]triazine-6-carbaldehyde?
imidazo[1,2-b][1,2,4]triazine-6-carbaldehyde has a molecular weight of 148.12 g/mol, XLogP of -0.06, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-b][1,2,4]triazine-6-carbaldehyde is sourced from PubChem (CID 58764268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).