C11H3F13O4S — CID 58764494
2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]-1-thiophen-2-ylethanone (PubChem CID 58764494) has the molecular formula C11H3F13O4S and a molecular weight of 478.18 g/mol. Its IUPAC name is 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]-1-thiophen-2-ylethanone.
| Compound Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 58764494 |
| Molecular Formula | C11H3F13O4S |
| Molecular Weight | 478.18 g/mol |
| Exact Mass | 477.95 |
| IUPAC Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]-1-thiophen-2-ylethanone |
| SMILES | O=C(c1cccs1)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C11H3F13O4S/c12-6(13,5(25)4-2-1-3-29-4)26-7(14,15)8(16,17)27-9(18,19)10(20,21)28-11(22,23)24/h1-3H |
| InChIKey | UVMBLXYUSATSHW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.18 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|