C11H2BrF13O4S — CID 58764497
1-(5-bromothiophen-2-yl)-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethanone (PubChem CID 58764497) has the molecular formula C11H2BrF13O4S and a molecular weight of 557.08 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethanone.
| Compound Name | 1-(5-bromothiophen-2-yl)-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethanone |
|---|---|
| PubChem CID | 58764497 |
| Molecular Formula | C11H2BrF13O4S |
| Molecular Weight | 557.08 g/mol |
| Exact Mass | 555.86 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethanone |
| SMILES | O=C(c1ccc(Br)s1)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C11H2BrF13O4S/c12-4-2-1-3(30-4)5(26)6(13,14)27-7(15,16)8(17,18)28-9(19,20)10(21,22)29-11(23,24)25/h1-2H |
| InChIKey | FTWMTABRFKFLIH-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.08 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|